Molecular Definition

Canonical SMILES OC1=C(C2C3=C(Oc4ccccc24)c5ccccc5OC3=O)C(=O)Oc6ccccc16
Formula C25H14O6
Molecular Weight 410.38 da
Stereocenters 0/1