Target Relevance

Molecular Definition

Canonical SMILES Cc1[nH]c(c2ccccc2)c(c3ccccc3)c1c4ccnc5ncnn45
Formula C22H17N5
Molecular Weight 351.40 da
Stereocenters 0/0