Molecular Definition

Canonical SMILES Cc1[nH]c(c2ccccc2)c(c3ccccc3)c1c4ccn[nH]4
Formula C20H17N3
Molecular Weight 299.37 da
Stereocenters 0/0