Target Relevance

Molecular Definition

Canonical SMILES CC(C)Oc1ccc(Nc2ccc(CCNCC(O)c3ccc(O)c(CO)c3)cc2)cc1
Formula C26H32N2O4
Molecular Weight 436.54 da
Stereocenters 0/1