Molecular Definition

Canonical SMILES CCOC(=O)CNC(=O)c1oc2cc(Cl)c(cc2c1C)C(=O)Oc3ccncc3C(=O)N4CCN(C5CC5)c6ccccc46
Formula C32H29ClN4O7
Molecular Weight 617.05 da
Stereocenters 0/0