Molecular Definition

Canonical SMILES Cc1c(oc2cc(Cl)c(Oc3ccncc3C(=O)N4CCN(C5CC5)c6ccccc46)cc12)C(=O)O
Formula C27H22ClN3O5
Molecular Weight 503.93 da
Stereocenters 0/0