Target Relevance

Molecular Definition

Canonical SMILES C[C@@H]1CN(CCN1c2ccc(cn2)C#N)c3nnc(Cc4ccccc4)c5ccc(cc35)C#N
Formula C27H23N7
Molecular Weight 445.52 da
Stereocenters 1/1