Molecular Definition

Canonical SMILES C[C@@H]1CN(CCN1c2ccc(cn2)C#N)c3nnc(Cc4ccccc4)c5ccc(cc35)C(F)(F)F
Formula C27H23F3N6
Molecular Weight 488.51 da
Stereocenters 1/1