Target Relevance

Molecular Definition

Canonical SMILES C[C@@H]1CN(CCN1c2ccc(cn2)C#N)c3nnc(Cc4ccccc4)c5ccc(Cl)cc35
Formula C26H23ClN6
Molecular Weight 454.95 da
Stereocenters 1/1