Target Relevance

Molecular Definition

Canonical SMILES CCN(CC)c1ccc(CN[C@H]2CCCC[C@H]2NC(=O)c3ccc(F)cc3)cc1
Formula C24H32FN3O
Molecular Weight 397.53 da
Stereocenters 2/2