Molecular Definition

Canonical SMILES NC(=N)c1ccc2[nH]c(nc2c1)c3cccc(c3O)c4ccccc4
Formula C20H16N4O
Molecular Weight 328.37 da
Stereocenters 0/0