Target Relevance

Molecular Definition

Canonical SMILES C[C@@](Cc1c[nH]c2ccccc12)(NC(=O)Nc3ccc(Cl)c(Cl)c3)C(=O)NCC4(CCCCC4)c5ccccn5
Formula C31H33Cl2N5O2
Molecular Weight 578.53 da
Stereocenters 1/1