Molecular Definition

Canonical SMILES Nc1ncnc2ccc(nc12)c3cccc(F)c3
Formula C13H9FN4
Molecular Weight 240.24 da
Stereocenters 0/0