Molecular Definition

Canonical SMILES CCOC(=O)C(C)Oc1ccc2C(=O)C(=COc2c1)c3ccc(O)cc3
Formula C20H18O6
Molecular Weight 354.35 da
Stereocenters 0/1