Molecular Definition

Canonical SMILES COc1cc(cc(OC)c1OC)c2cnc3c(nccn23)N4CCOCC4
Formula C19H22N4O4
Molecular Weight 370.40 da
Stereocenters 0/0