Target Relevance

Molecular Definition

Canonical SMILES Cc1cccc(n1)c2nn(CC(=S)Nc3ccccc3F)cc2c4ccc5ncnn5c4
Formula C23H18FN7S
Molecular Weight 443.50 da
Stereocenters 0/0