Target Relevance

Molecular Definition

Canonical SMILES Cc1cccc(n1)c2nn(CC(=O)Nc3cccc(c3)C#N)cc2c4ccc5ncnn5c4
Formula C24H18N8O
Molecular Weight 434.45 da
Stereocenters 0/0