Molecular Definition

Canonical SMILES CN(CCNC(=O)C)c1cccc(OCCCCc2ccccc2)c1
Formula C21H28N2O2
Molecular Weight 340.46 da
Stereocenters 0/0