Molecular Definition

Canonical SMILES CC(=O)NCCc1c[nH]c2ccc(OCCCOc3ccccc3)cc12
Formula C21H24N2O3
Molecular Weight 352.43 da
Stereocenters 0/0