Target Relevance

Molecular Definition

Canonical SMILES CCS(=O)(=O)c1ccc(OC)c(c1)c2ccc(CN3CCCCCC3c4ccccc4C)[nH]2
Formula C27H34N2O3S
Molecular Weight 466.64 da
Stereocenters 0/1