Molecular Definition

Canonical SMILES Cc1ccc(cc1)C(=O)NC(=N)N2CCc3ccccc23
Formula C17H17N3O
Molecular Weight 279.34 da
Stereocenters 0/0