Target Relevance

Molecular Definition

Canonical SMILES CN1C(=O)c2ccccc2[S+]([O-])c3ccc(cc13)C(=O)NCCc4cccs4
Formula C21H18N2O3S2
Molecular Weight 410.51 da
Stereocenters 0/1