Target Relevance

Molecular Definition

Canonical SMILES COC(=O)c1ccc(cc1)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](C)C(=O)N[C@@H](C3CCCC3)C(=O)N[C@@H](CCCC[N+](C)(C)C)C(=O)N[C@H](CO)C(=O)N
Formula C40H58N7O9
Molecular Weight 780.93 da
Stereocenters 5/6