Molecular Definition

Canonical SMILES CC(C)c1cc(C(=O)N2CCc3onc(C(=O)NCCCCCCC(=O)NO)c3C2)c(O)cc1O
Formula C24H32N4O7
Molecular Weight 488.53 da
Stereocenters 0/0