Molecular Definition

Canonical SMILES NC1Cc2cc(Oc3ccccc3)ccc2N4C(=O)NN=C14
Formula C16H14N4O2
Molecular Weight 294.31 da
Stereocenters 0/1