Target Relevance

Molecular Definition

Canonical SMILES CCN1C(=O)N(CC)C(=O)C(=Cc2cc(c3ccccc3)n(c4ccc(Br)cc4)c2c5ccccc5)C1=O
Formula C31H26BrN3O3
Molecular Weight 568.46 da
Stereocenters 0/0