Target Relevance

Molecular Definition

Canonical SMILES O[C@@H](CC[C@@H]1[C@H](N(C1=O)c2ccc(F)cc2)c3ccc(O[C@@H]4O[C@@H]([C@@H](O)[C@H](O)[C@H]4O)C(=O)O)cc3)c5ccc(F)cc5
Formula C30H29F2NO9
Molecular Weight 585.55 da
Stereocenters 8/8