Target Relevance

Molecular Definition

Canonical SMILES CCC(N1CC[C@H]1[C@H](N)c2cccc(Cl)c2)c3ccccc3
Formula C19H23ClN2
Molecular Weight 314.85 da
Stereocenters 2/3