Target Relevance

Molecular Definition

Canonical SMILES COc1cccc2c1Cc3ccn(CC(C)N)c23
Formula C15H18N2O
Molecular Weight 242.32 da
Stereocenters 0/1