Molecular Definition

Canonical SMILES NCCCC[C@H](NC(=O)CN(C1CC1)C(=O)CCc2ccccc2)B(O)O
Formula C19H30BN3O4
Molecular Weight 375.27 da
Stereocenters 1/1