Molecular Definition

Canonical SMILES OC1=C(Oc2cc(O)ccc2C1=O)c3ccc(O)c(O)c3
Formula C15H10O6
Molecular Weight 286.24 da
Stereocenters 0/0