Target Relevance

Molecular Definition

Canonical SMILES CC(=CCC\C(=C\CC\C(=C\Cc1cccc2c(c[nH]c12)C3=C(O)C(=CC(=O)C3=O)O)\C)\C)C
Formula C29H33NO4
Molecular Weight 459.58 da
Stereocenters 0/0