Target Relevance

Molecular Definition

Canonical SMILES CCc1occ(n1)c2ccc(Oc3ccc(CCC(N)(CO)COP(=O)(O)O)cc3)cc2
Formula C22H27N2O7P
Molecular Weight 462.43 da
Stereocenters 0/1