Target Relevance

Molecular Definition

Canonical SMILES CCOC(=O)COc1cc(C)c2C(=O)C(=COc2c1)c3nc(C)cs3
Formula C18H17NO5S
Molecular Weight 359.40 da
Stereocenters 0/0