Target Relevance

Molecular Definition

Canonical SMILES CCc1ccc(CCc2ccc(CCC(N)(CO)COP(=O)(O)O)cc2)cc1
Formula C21H30NO5P
Molecular Weight 407.44 da
Stereocenters 0/1