Target Relevance

Molecular Definition

Canonical SMILES CC(C)C[C@H](NC(=O)[C@H](CCc1ccc(O)cc1)N[C@H](C)C(=O)O)C(=O)Nc2ccccc2
Formula C25H33N3O5
Molecular Weight 455.55 da
Stereocenters 3/3