Molecular Definition

Canonical SMILES CC(C)c1cc(Cn2c(C)c(CCCCC(=O)O)c3ccccc23)ccc1O
Formula C24H29NO3
Molecular Weight 379.49 da
Stereocenters 0/0