Target Relevance

Molecular Definition

Canonical SMILES CCCCCCCCN1C(=O)NN(C1=O)c2ccc(cc2)S(=O)(=O)Nc3ccc(CCNC[C@H](O)c4cccnc4)cc3
Formula C31H40N6O5S
Molecular Weight 608.75 da
Stereocenters 1/1