Target Relevance

Molecular Definition

Canonical SMILES NC(=N)NCCC[C@H](NC(=O)[C@@H](CC1CCCCC1)NCCC(=O)O)C(=O)NCc2ccc(cc2)C(=N)N
Formula C26H42N8O4
Molecular Weight 530.66 da
Stereocenters 2/2