Target Relevance

Molecular Definition

Canonical SMILES CC(C)(C)c1ccc(CC(=O)N2Cc3ccc(nc3Nc4ccccc24)C(F)(F)F)cc1
Formula C25H24F3N3O
Molecular Weight 439.47 da
Stereocenters 0/0