Target Relevance

Molecular Definition

Canonical SMILES FC(F)(F)c1ccc2CN(CCNc2n1)C(=O)Cc3cccc(OC4CCCC4)c3
Formula C22H24F3N3O2
Molecular Weight 419.44 da
Stereocenters 0/0