Molecular Definition

Canonical SMILES OC(=O)Cc1ccc(Nc2nc(nc3CCCSc23)c4ccccc4F)cc1
Formula C21H18FN3O2S
Molecular Weight 395.45 da
Stereocenters 0/0