Molecular Definition

Canonical SMILES NC1=C(Br)C(=O)c2cccnc2C1=O
Formula C9H5BrN2O2
Molecular Weight 253.05 da
Stereocenters 0/0