Molecular Definition

Canonical SMILES COc1cccc(CNc2ccc(cc2)S(=O)(=O)Nc3ccccc3)c1O
Formula C20H20N2O4S
Molecular Weight 384.45 da
Stereocenters 0/0