Molecular Definition

Canonical SMILES COc1cccc(CNc2ccc(cc2)S(=O)(=O)Nc3cccc4ccncc34)c1O
Formula C23H21N3O4S
Molecular Weight 435.50 da
Stereocenters 0/0