Molecular Definition

Canonical SMILES COc1cccc(CNc2ccc(cc2)S(=O)(=O)Nc3nc4ccccc4[nH]3)c1O
Formula C21H20N4O4S
Molecular Weight 424.47 da
Stereocenters 0/0