Molecular Definition

Canonical SMILES COc1cccc(CNc2ccc(cc2)S(=O)(=O)Nc3oc4ccccc4n3)c1O
Formula C21H19N3O5S
Molecular Weight 425.46 da
Stereocenters 0/0