Molecular Definition

Canonical SMILES COc1cccc(CNc2ccc(cc2)S(=O)(=O)Nc3nc4ccccc4s3)c1O
Formula C21H19N3O4S2
Molecular Weight 441.52 da
Stereocenters 0/0