Molecular Definition

Canonical SMILES O=C(Nc1cccnc1)c2ccc(cc2)C3CCCCC3
Formula C18H20N2O
Molecular Weight 280.36 da
Stereocenters 0/0