Target Relevance

Molecular Definition

Canonical SMILES CCC1=C(C)C2=Cc3c(CCNC(=O)C)c4cc(OC)ccc4n3[B-](F)(F)[N+]2=C1C
Formula C22H26BF2N3O2
Molecular Weight 413.27 da
Stereocenters 0/0